C22H18N4O3 — CID 55641236
[2-(naphthalen-1-ylamino)-2-oxoethyl] 5-methyl-1-pyridin-2-ylpyrazole-4-carboxylate (PubChem CID 55641236) has the molecular formula C22H18N4O3 and a molecular weight of 386.41 g/mol. Its IUPAC name is [2-(naphthalen-1-ylamino)-2-oxoethyl] 5-methyl-1-pyridin-2-ylpyrazole-4-carboxylate.
| Compound Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] 5-methyl-1-pyridin-2-ylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 55641236 |
| Molecular Formula | C22H18N4O3 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] 5-methyl-1-pyridin-2-ylpyrazole-4-carboxylate |
| SMILES | Cc1c(C(=O)OCC(=O)Nc2cccc3ccccc23)cnn1-c1ccccn1 |
| InChI | InChI=1S/C22H18N4O3/c1-15-18(13-24-26(15)20-11-4-5-12-23-20)22(28)29-14-21(27)25-19-10-6-8-16-7-2-3-9-17(16)19/h2-13H,14H2,1H3,(H,25,27) |
| InChIKey | WZNLKTKZZVWRAQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |