C26H24N4O3 — CID 55648975
[2-(2-benzylanilino)-2-oxoethyl] 5-ethyl-1-pyridin-2-ylpyrazole-4-carboxylate (PubChem CID 55648975) has the molecular formula C26H24N4O3 and a molecular weight of 440.50 g/mol. Its IUPAC name is [2-(2-benzylanilino)-2-oxoethyl] 5-ethyl-1-pyridin-2-ylpyrazole-4-carboxylate.
| Compound Name | [2-(2-benzylanilino)-2-oxoethyl] 5-ethyl-1-pyridin-2-ylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 55648975 |
| Molecular Formula | C26H24N4O3 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | [2-(2-benzylanilino)-2-oxoethyl] 5-ethyl-1-pyridin-2-ylpyrazole-4-carboxylate |
| SMILES | CCc1c(C(=O)OCC(=O)Nc2ccccc2Cc2ccccc2)cnn1-c1ccccn1 |
| InChI | InChI=1S/C26H24N4O3/c1-2-23-21(17-28-30(23)24-14-8-9-15-27-24)26(32)33-18-25(31)29-22-13-7-6-12-20(22)16-19-10-4-3-5-11-19/h3-15,17H,2,16,18H2,1H3,(H,29,31) |
| InChIKey | XHNNDVRBTPCKDX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |