C25H23N3O2S — CID 166336013
(4-benzylsulfanylphenyl)methyl 5-ethyl-1-pyridin-2-ylpyrazole-4-carboxylate (PubChem CID 166336013) has the molecular formula C25H23N3O2S and a molecular weight of 429.55 g/mol. Its IUPAC name is (4-benzylsulfanylphenyl)methyl 5-ethyl-1-pyridin-2-ylpyrazole-4-carboxylate.
| Compound Name | (4-benzylsulfanylphenyl)methyl 5-ethyl-1-pyridin-2-ylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 166336013 |
| Molecular Formula | C25H23N3O2S |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | (4-benzylsulfanylphenyl)methyl 5-ethyl-1-pyridin-2-ylpyrazole-4-carboxylate |
| SMILES | CCc1c(C(=O)OCc2ccc(SCc3ccccc3)cc2)cnn1-c1ccccn1 |
| InChI | InChI=1S/C25H23N3O2S/c1-2-23-22(16-27-28(23)24-10-6-7-15-26-24)25(29)30-17-19-11-13-21(14-12-19)31-18-20-8-4-3-5-9-20/h3-16H,2,17-18H2,1H3 |
| InChIKey | KZUCJEMOHJJJME-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |