C24H18N4O3S — CID 46425726
(2-oxo-2-phenothiazin-10-ylethyl) 5-methyl-1-pyridin-2-ylpyrazole-4-carboxylate (PubChem CID 46425726) has the molecular formula C24H18N4O3S and a molecular weight of 442.50 g/mol. Its IUPAC name is (2-oxo-2-phenothiazin-10-ylethyl) 5-methyl-1-pyridin-2-ylpyrazole-4-carboxylate.
| Compound Name | (2-oxo-2-phenothiazin-10-ylethyl) 5-methyl-1-pyridin-2-ylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 46425726 |
| Molecular Formula | C24H18N4O3S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | (2-oxo-2-phenothiazin-10-ylethyl) 5-methyl-1-pyridin-2-ylpyrazole-4-carboxylate |
| SMILES | Cc1c(C(=O)OCC(=O)N2c3ccccc3Sc3ccccc32)cnn1-c1ccccn1 |
| InChI | InChI=1S/C24H18N4O3S/c1-16-17(14-26-28(16)22-12-6-7-13-25-22)24(30)31-15-23(29)27-18-8-2-4-10-20(18)32-21-11-5-3-9-19(21)27/h2-14H,15H2,1H3 |
| InChIKey | SMRCJICCIUNTDM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |