C28H34N4O6S2 — CID 135984964
3-[3-hydroxy-6-oxo-4-(3-pentylsulfonylphenyl)-2H-pyrrolo[3,4-c]pyrrol-1-yl]-N-[4-(methylamino)butyl]benzenesulfonamide (PubChem CID 135984964) has the molecular formula C28H34N4O6S2 and a molecular weight of 586.74 g/mol. Its IUPAC name is 3-[3-hydroxy-6-oxo-4-(3-pentylsulfonylphenyl)-2H-pyrrolo[3,4-c]pyrrol-1-yl]-N-[4-(methylamino)butyl]benzenesulfonamide.
| Compound Name | 3-[3-hydroxy-6-oxo-4-(3-pentylsulfonylphenyl)-2H-pyrrolo[3,4-c]pyrrol-1-yl]-N-[4-(methylamino)butyl]benzenesulfonamide |
|---|---|
| PubChem CID | 135984964 |
| Molecular Formula | C28H34N4O6S2 |
| Molecular Weight | 586.74 g/mol |
| Exact Mass | 586.19 |
| IUPAC Name | 3-[3-hydroxy-6-oxo-4-(3-pentylsulfonylphenyl)-2H-pyrrolo[3,4-c]pyrrol-1-yl]-N-[4-(methylamino)butyl]benzenesulfonamide |
| SMILES | CCCCCS(=O)(=O)c1cccc(C2=NC(=O)c3c(-c4cccc(S(=O)(=O)NCCCCNC)c4)[nH]c(O)c32)c1 |
| InChI | InChI=1S/C28H34N4O6S2/c1-3-4-7-16-39(35,36)21-12-8-10-19(17-21)25-23-24(28(34)31-25)26(32-27(23)33)20-11-9-13-22(18-20)40(37,38)30-15-6-5-14-29-2/h8-13,17-18,29-30,32-33H,3-7,14-16H2,1-2H3 |
| InChIKey | MKVDHFPXABZTIP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 157.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.74 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|