C40H42N12+4 — CID 135988609
5,10,15,20-tetrakis(1,3-dimethylimidazol-1-ium-4-yl)-21,23-dihydroporphyrin (PubChem CID 135988609) has the molecular formula C40H42N12+4 and a molecular weight of 690.86 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(1,3-dimethylimidazol-1-ium-4-yl)-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(1,3-dimethylimidazol-1-ium-4-yl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135988609 |
| Molecular Formula | C40H42N12+4 |
| Molecular Weight | 690.86 g/mol |
| Exact Mass | 690.36 |
| IUPAC Name | 5,10,15,20-tetrakis(1,3-dimethylimidazol-1-ium-4-yl)-21,23-dihydroporphyrin |
| SMILES | Cn1c[n+](C)cc1-c1c2nc(c(-c3c[n+](C)cn3C)c3ccc([nH]3)c(-c3c[n+](C)cn3C)c3nc(c(-c4c[n+](C)cn4C)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C40H42N12/c1-45-17-33(49(5)21-45)37-25-9-11-27(41-25)38(34-18-46(2)22-50(34)6)29-13-15-31(43-29)40(36-20-48(4)24-52(36)8)32-16-14-30(44-32)39(28-12-10-26(37)42-28)35-19-47(3)23-51(35)7/h9-24,41,44H,1-8H3/q+4/b37-25+,37-26+,38-27+,38-29+,39-28+,39-30+,40-31+,40-32+ |
| InChIKey | IJMPVPKRVUBJQG-OJBPLZGDSA-N |
| XLogP | 3.98 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.86 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|