C30H37N4+ — CID 171352081
3-[2-[3-[2-(1H-indol-3-yl)ethyl]-4-methyl-2,5-dipropylimidazol-1-ium-1-yl]ethyl]-1H-indole (PubChem CID 171352081) has the molecular formula C30H37N4+ and a molecular weight of 453.65 g/mol. Its IUPAC name is 3-[2-[3-[2-(1H-indol-3-yl)ethyl]-4-methyl-2,5-dipropylimidazol-1-ium-1-yl]ethyl]-1H-indole.
| Compound Name | 3-[2-[3-[2-(1H-indol-3-yl)ethyl]-4-methyl-2,5-dipropylimidazol-1-ium-1-yl]ethyl]-1H-indole |
|---|---|
| PubChem CID | 171352081 |
| Molecular Formula | C30H37N4+ |
| Molecular Weight | 453.65 g/mol |
| Exact Mass | 453.30 |
| IUPAC Name | 3-[2-[3-[2-(1H-indol-3-yl)ethyl]-4-methyl-2,5-dipropylimidazol-1-ium-1-yl]ethyl]-1H-indole |
| SMILES | CCCc1c(C)n(CCc2c[nH]c3ccccc23)c(CCC)[n+]1CCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C30H37N4/c1-4-10-29-22(3)33(18-16-23-20-31-27-14-8-6-12-25(23)27)30(11-5-2)34(29)19-17-24-21-32-28-15-9-7-13-26(24)28/h6-9,12-15,20-21,31-32H,4-5,10-11,16-19H2,1-3H3/q+1 |
| InChIKey | SAXHXVMJIVYVCV-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 40.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.65 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|