C19H18N4S — CID 135142494
4-amino-3-[2-(1H-indol-3-yl)ethyl]-6-methylquinazoline-2-thione (PubChem CID 135142494) has the molecular formula C19H18N4S and a molecular weight of 334.45 g/mol. Its IUPAC name is 4-amino-3-[2-(1H-indol-3-yl)ethyl]-6-methylquinazoline-2-thione.
| Compound Name | 4-amino-3-[2-(1H-indol-3-yl)ethyl]-6-methylquinazoline-2-thione |
|---|---|
| PubChem CID | 135142494 |
| Molecular Formula | C19H18N4S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 4-amino-3-[2-(1H-indol-3-yl)ethyl]-6-methylquinazoline-2-thione |
| SMILES | Cc1ccc2nc(=S)n(CCc3c[nH]c4ccccc34)c(N)c2c1 |
| InChI | InChI=1S/C19H18N4S/c1-12-6-7-17-15(10-12)18(20)23(19(24)22-17)9-8-13-11-21-16-5-3-2-4-14(13)16/h2-7,10-11,21H,8-9,20H2,1H3 |
| InChIKey | ZMSSEWOKJTWMBE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 59.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|