C23H34N3+ — CID 171342442
3-[2-[4,5-dimethyl-3-(3-methylbutyl)-2-propylimidazol-3-ium-1-yl]ethyl]-1H-indole (PubChem CID 171342442) has the molecular formula C23H34N3+ and a molecular weight of 352.55 g/mol. Its IUPAC name is 3-[2-[4,5-dimethyl-3-(3-methylbutyl)-2-propylimidazol-3-ium-1-yl]ethyl]-1H-indole.
| Compound Name | 3-[2-[4,5-dimethyl-3-(3-methylbutyl)-2-propylimidazol-3-ium-1-yl]ethyl]-1H-indole |
|---|---|
| PubChem CID | 171342442 |
| Molecular Formula | C23H34N3+ |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.27 |
| IUPAC Name | 3-[2-[4,5-dimethyl-3-(3-methylbutyl)-2-propylimidazol-3-ium-1-yl]ethyl]-1H-indole |
| SMILES | CCCc1n(CCc2c[nH]c3ccccc23)c(C)c(C)[n+]1CCC(C)C |
| InChI | InChI=1S/C23H34N3/c1-6-9-23-25(14-12-17(2)3)18(4)19(5)26(23)15-13-20-16-24-22-11-8-7-10-21(20)22/h7-8,10-11,16-17,24H,6,9,12-15H2,1-5H3/q+1 |
| InChIKey | QKPAWTFJUYORCX-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 24.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|