C16H25N3 — CID 83960679
1-N-[2-(1H-indol-3-yl)ethyl]hexane-1,2-diamine (PubChem CID 83960679) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is 1-N-[2-(1H-indol-3-yl)ethyl]hexane-1,2-diamine.
| Compound Name | 1-N-[2-(1H-indol-3-yl)ethyl]hexane-1,2-diamine |
|---|---|
| PubChem CID | 83960679 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 1-N-[2-(1H-indol-3-yl)ethyl]hexane-1,2-diamine |
| SMILES | CCCCC(N)CNCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H25N3/c1-2-3-6-14(17)12-18-10-9-13-11-19-16-8-5-4-7-15(13)16/h4-5,7-8,11,14,18-19H,2-3,6,9-10,12,17H2,1H3 |
| InChIKey | BUPOGUQDHIVKDX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|