C27H29N9O3 — CID 135988709
[5-[6-[(E)-N'-hydroxycarbamimidoyl]-1H-benzimidazol-2-yl]-1-methyl-3-[4-(pyrazol-1-ylmethyl)phenyl]pyrazol-4-yl] N,N-diethylcarbamate (PubChem CID 135988709) has the molecular formula C27H29N9O3 and a molecular weight of 527.59 g/mol. Its IUPAC name is [5-[6-[(E)-N'-hydroxycarbamimidoyl]-1H-benzimidazol-2-yl]-1-methyl-3-[4-(pyrazol-1-ylmethyl)phenyl]pyrazol-4-yl] N,N-diethylcarbamate.
| Compound Name | [5-[6-[(E)-N'-hydroxycarbamimidoyl]-1H-benzimidazol-2-yl]-1-methyl-3-[4-(pyrazol-1-ylmethyl)phenyl]pyrazol-4-yl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 135988709 |
| Molecular Formula | C27H29N9O3 |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | [5-[6-[(E)-N'-hydroxycarbamimidoyl]-1H-benzimidazol-2-yl]-1-methyl-3-[4-(pyrazol-1-ylmethyl)phenyl]pyrazol-4-yl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1c(-c2ccc(Cn3cccn3)cc2)nn(C)c1-c1nc2ccc(/C(N)=N\O)cc2[nH]1 |
| InChI | InChI=1S/C27H29N9O3/c1-4-35(5-2)27(37)39-24-22(18-9-7-17(8-10-18)16-36-14-6-13-29-36)32-34(3)23(24)26-30-20-12-11-19(25(28)33-38)15-21(20)31-26/h6-15,38H,4-5,16H2,1-3H3,(H2,28,33)(H,30,31) |
| InChIKey | RJRDVHFOECGSSK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 152.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|