C17H26N4O — CID 135990815
6-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-methyl-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-4-one (PubChem CID 135990815) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is 6-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-methyl-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-4-one.
| Compound Name | 6-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-methyl-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135990815 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 6-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-methyl-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-4-one |
| SMILES | Cc1nc2c(c(=O)[nH]1)CN(C[C@@H]1CCCN3CCCC[C@H]13)C2 |
| InChI | InChI=1S/C17H26N4O/c1-12-18-15-11-20(10-14(15)17(22)19-12)9-13-5-4-8-21-7-3-2-6-16(13)21/h13,16H,2-11H2,1H3,(H,18,19,22)/t13-,16+/m0/s1 |
| InChIKey | SCEPWFAXGJXDOD-XJKSGUPXSA-N |
| XLogP | 1.66 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |