C20H30N4O2 — CID 72877883
6-[3-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]propanoyl]-2,3-dimethyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-one (PubChem CID 72877883) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 6-[3-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]propanoyl]-2,3-dimethyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-one.
| Compound Name | 6-[3-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]propanoyl]-2,3-dimethyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 72877883 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 6-[3-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]propanoyl]-2,3-dimethyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-one |
| SMILES | Cc1nc2c(c(=O)n1C)CN(C(=O)CC[C@@H]1CCCN3CCCC[C@H]13)C2 |
| InChI | InChI=1S/C20H30N4O2/c1-14-21-17-13-24(12-16(17)20(26)22(14)2)19(25)9-8-15-6-5-11-23-10-4-3-7-18(15)23/h15,18H,3-13H2,1-2H3/t15-,18+/m0/s1 |
| InChIKey | DMYFWVVPGSKKGA-MAUKXSAKSA-N |
| XLogP | 1.98 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |