C20H28ClN5O3 — CID 171712516
(1R,2S,8R,9S)-8-(2,3-dimethyl-4-oxo-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;hydrochloride (PubChem CID 171712516) has the molecular formula C20H28ClN5O3 and a molecular weight of 421.93 g/mol. Its IUPAC name is (1R,2S,8R,9S)-8-(2,3-dimethyl-4-oxo-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;hydrochloride.
| Compound Name | (1R,2S,8R,9S)-8-(2,3-dimethyl-4-oxo-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;hydrochloride |
|---|---|
| PubChem CID | 171712516 |
| Molecular Formula | C20H28ClN5O3 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | (1R,2S,8R,9S)-8-(2,3-dimethyl-4-oxo-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;hydrochloride |
| SMILES | Cc1nc2c(c(=O)n1C)CN(C(=O)[C@H]1[C@@H]3CNC[C@@H](C3)[C@@H]3CCCC(=O)N31)C2.Cl |
| InChI | InChI=1S/C20H27N5O3.ClH/c1-11-22-15-10-24(9-14(15)19(27)23(11)2)20(28)18-13-6-12(7-21-8-13)16-4-3-5-17(26)25(16)18;/h12-13,16,18,21H,3-10H2,1-2H3;1H/t12-,13+,16+,18-;/m1./s1 |
| InChIKey | ICBJTJNPMIBXNC-JEFAEPTISA-N |
| XLogP | 0.34 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |