C20H30N4O2 — CID 164696666
(1R,2S,8S,9S)-11-[(2-methyl-6-oxo-1H-pyrimidin-4-yl)methyl]-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 164696666) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is (1R,2S,8S,9S)-11-[(2-methyl-6-oxo-1H-pyrimidin-4-yl)methyl]-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8S,9S)-11-[(2-methyl-6-oxo-1H-pyrimidin-4-yl)methyl]-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 164696666 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | (1R,2S,8S,9S)-11-[(2-methyl-6-oxo-1H-pyrimidin-4-yl)methyl]-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | CCC[C@H]1[C@H]2C[C@H](CN(Cc3cc(=O)[nH]c(C)n3)C2)[C@@H]2CCCC(=O)N21 |
| InChI | InChI=1S/C20H30N4O2/c1-3-5-17-14-8-15(18-6-4-7-20(26)24(17)18)11-23(10-14)12-16-9-19(25)22-13(2)21-16/h9,14-15,17-18H,3-8,10-12H2,1-2H3,(H,21,22,25)/t14-,15+,17-,18-/m0/s1 |
| InChIKey | BOKIVVHQQXOUKX-MVJTYMMSSA-N |
| XLogP | 2.08 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |