C20H27N5O2 — CID 70734724
2-[[(4aS,8aR)-1-[2-(methylamino)ethyl]-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]methyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 70734724) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is 2-[[(4aS,8aR)-1-[2-(methylamino)ethyl]-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]methyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[[(4aS,8aR)-1-[2-(methylamino)ethyl]-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]methyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 70734724 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 2-[[(4aS,8aR)-1-[2-(methylamino)ethyl]-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]methyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | CNCCN1C(=O)CC[C@H]2CN(Cc3cc(=O)n4ccccc4n3)CC[C@H]21 |
| InChI | InChI=1S/C20H27N5O2/c1-21-8-11-24-17-7-10-23(13-15(17)5-6-19(24)26)14-16-12-20(27)25-9-3-2-4-18(25)22-16/h2-4,9,12,15,17,21H,5-8,10-11,13-14H2,1H3/t15-,17+/m0/s1 |
| InChIKey | YFQQBWXPXOHNNY-DOTOQJQBSA-N |
| XLogP | 0.73 |
| TPSA | 69.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |