C18H26N4O2 — CID 137105952
(4aR,8aS)-1-cyclopropyl-6-[(1S)-1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 137105952) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is (4aR,8aS)-1-cyclopropyl-6-[(1S)-1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aR,8aS)-1-cyclopropyl-6-[(1S)-1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 137105952 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | (4aR,8aS)-1-cyclopropyl-6-[(1S)-1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | Cc1cc(=O)[nH]c([C@H](C)N2CC[C@H]3[C@H](CCC(=O)N3C3CC3)C2)n1 |
| InChI | InChI=1S/C18H26N4O2/c1-11-9-16(23)20-18(19-11)12(2)21-8-7-15-13(10-21)3-6-17(24)22(15)14-4-5-14/h9,12-15H,3-8,10H2,1-2H3,(H,19,20,23)/t12-,13+,15-/m0/s1 |
| InChIKey | QWXVIXLOIVNCJR-GUTXKFCHSA-N |
| XLogP | 1.61 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |