C19H29N5O2 — CID 162638478
6-[4-[(1R,2S,5S)-3,7-diazabicyclo[3.3.1]nonan-2-yl]butanoyl]-2,3-dimethyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-one (PubChem CID 162638478) has the molecular formula C19H29N5O2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 6-[4-[(1R,2S,5S)-3,7-diazabicyclo[3.3.1]nonan-2-yl]butanoyl]-2,3-dimethyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-one.
| Compound Name | 6-[4-[(1R,2S,5S)-3,7-diazabicyclo[3.3.1]nonan-2-yl]butanoyl]-2,3-dimethyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 162638478 |
| Molecular Formula | C19H29N5O2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | 6-[4-[(1R,2S,5S)-3,7-diazabicyclo[3.3.1]nonan-2-yl]butanoyl]-2,3-dimethyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-one |
| SMILES | Cc1nc2c(c(=O)n1C)CN(C(=O)CCC[C@@H]1NC[C@@H]3CNC[C@H]1C3)C2 |
| InChI | InChI=1S/C19H29N5O2/c1-12-22-17-11-24(10-15(17)19(26)23(12)2)18(25)5-3-4-16-14-6-13(8-21-16)7-20-9-14/h13-14,16,20-21H,3-11H2,1-2H3/t13-,14+,16-/m0/s1 |
| InChIKey | XBUQDIGHTNUSPP-LZWOXQAQSA-N |
| XLogP | 0.30 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |