C10H13N7O2 — CID 135990879
N-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]ethyl]-2H-triazole-4-carboxamide (PubChem CID 135990879) has the molecular formula C10H13N7O2 and a molecular weight of 263.26 g/mol. Its IUPAC name is N-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]ethyl]-2H-triazole-4-carboxamide.
| Compound Name | N-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]ethyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 135990879 |
| Molecular Formula | C10H13N7O2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | N-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]ethyl]-2H-triazole-4-carboxamide |
| SMILES | Cc1cc(=O)[nH]c(NCCNC(=O)c2cn[nH]n2)n1 |
| InChI | InChI=1S/C10H13N7O2/c1-6-4-8(18)15-10(14-6)12-3-2-11-9(19)7-5-13-17-16-7/h4-5H,2-3H2,1H3,(H,11,19)(H,13,16,17)(H2,12,14,15,18) |
| InChIKey | WIXBAPRGVUIUSQ-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|