C30H32N6O9 — CID 135991826
(2S)-2-[[4-[[2-[[(4S)-4-amino-4-carboxybutanoyl]amino]-4-oxo-3H-quinazolin-6-yl]methyl-prop-2-ynylamino]benzoyl]-methylamino]pentanedioic acid (PubChem CID 135991826) has the molecular formula C30H32N6O9 and a molecular weight of 620.62 g/mol. Its IUPAC name is (2S)-2-[[4-[[2-[[(4S)-4-amino-4-carboxybutanoyl]amino]-4-oxo-3H-quinazolin-6-yl]methyl-prop-2-ynylamino]benzoyl]-methylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[4-[[2-[[(4S)-4-amino-4-carboxybutanoyl]amino]-4-oxo-3H-quinazolin-6-yl]methyl-prop-2-ynylamino]benzoyl]-methylamino]pentanedioic acid |
|---|---|
| PubChem CID | 135991826 |
| Molecular Formula | C30H32N6O9 |
| Molecular Weight | 620.62 g/mol |
| Exact Mass | 620.22 |
| IUPAC Name | (2S)-2-[[4-[[2-[[(4S)-4-amino-4-carboxybutanoyl]amino]-4-oxo-3H-quinazolin-6-yl]methyl-prop-2-ynylamino]benzoyl]-methylamino]pentanedioic acid |
| SMILES | C#CCN(Cc1ccc2nc(NC(=O)CC[C@H](N)C(=O)O)[nH]c(=O)c2c1)c1ccc(C(=O)N(C)[C@@H](CCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C30H32N6O9/c1-3-14-36(19-7-5-18(6-8-19)27(41)35(2)23(29(44)45)11-13-25(38)39)16-17-4-10-22-20(15-17)26(40)34-30(32-22)33-24(37)12-9-21(31)28(42)43/h1,4-8,10,15,21,23H,9,11-14,16,31H2,2H3,(H,38,39)(H,42,43)(H,44,45)(H2,32,33,34,37,40)/t21-,23-/m0/s1 |
| InChIKey | CPVJPDFDYOFQOO-GMAHTHKFSA-N |
| XLogP | 1.08 |
| TPSA | 236.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.62 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|