C26H26N4O6 — CID 136649849
(2S)-2-[[2-[4-[(2-methyl-4-oxo-3H-quinazolin-6-yl)methyl-prop-2-ynylamino]phenyl]acetyl]amino]pentanedioic acid (PubChem CID 136649849) has the molecular formula C26H26N4O6 and a molecular weight of 490.52 g/mol. Its IUPAC name is (2S)-2-[[2-[4-[(2-methyl-4-oxo-3H-quinazolin-6-yl)methyl-prop-2-ynylamino]phenyl]acetyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[2-[4-[(2-methyl-4-oxo-3H-quinazolin-6-yl)methyl-prop-2-ynylamino]phenyl]acetyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 136649849 |
| Molecular Formula | C26H26N4O6 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | (2S)-2-[[2-[4-[(2-methyl-4-oxo-3H-quinazolin-6-yl)methyl-prop-2-ynylamino]phenyl]acetyl]amino]pentanedioic acid |
| SMILES | C#CCN(Cc1ccc2nc(C)[nH]c(=O)c2c1)c1ccc(CC(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C26H26N4O6/c1-3-12-30(15-18-6-9-21-20(13-18)25(34)28-16(2)27-21)19-7-4-17(5-8-19)14-23(31)29-22(26(35)36)10-11-24(32)33/h1,4-9,13,22H,10-12,14-15H2,2H3,(H,29,31)(H,32,33)(H,35,36)(H,27,28,34)/t22-/m0/s1 |
| InChIKey | BGFVBZQRTKWNQV-QFIPXVFZSA-N |
| XLogP | 1.85 |
| TPSA | 152.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|