C11H8N4O — CID 135992006
3-phenyl-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one (PubChem CID 135992006) has the molecular formula C11H8N4O and a molecular weight of 212.21 g/mol. Its IUPAC name is 3-phenyl-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one.
| Compound Name | 3-phenyl-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135992006 |
| Molecular Formula | C11H8N4O |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 3-phenyl-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2n[nH]c(-c3ccccc3)c12 |
| InChI | InChI=1S/C11H8N4O/c16-11-8-9(7-4-2-1-3-5-7)14-15-10(8)12-6-13-11/h1-6H,(H2,12,13,14,15,16) |
| InChIKey | KCPLJPHQKPGNHT-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |