C10H10N4O — CID 14775202
3-amino-5-phenyl-1H-pyrazole-4-carboxamide (PubChem CID 14775202) has the molecular formula C10H10N4O and a molecular weight of 202.22 g/mol. Its IUPAC name is 3-amino-5-phenyl-1H-pyrazole-4-carboxamide.
| Compound Name | 3-amino-5-phenyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 14775202 |
| Molecular Formula | C10H10N4O |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 3-amino-5-phenyl-1H-pyrazole-4-carboxamide |
| SMILES | NC(=O)c1c(N)n[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C10H10N4O/c11-9-7(10(12)15)8(13-14-9)6-4-2-1-3-5-6/h1-5H,(H2,12,15)(H3,11,13,14) |
| InChIKey | IKDWUDVONCJEGA-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |