C22H29N5O4S — CID 135992025
5-[2-[(6S)-2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pyrido[2,3-d]pyrimidin-6-yl]ethyl]-N-[(3S)-2,6-dioxoheptan-3-yl]-4-methylthiophene-2-carboxamide (PubChem CID 135992025) has the molecular formula C22H29N5O4S and a molecular weight of 459.57 g/mol. Its IUPAC name is 5-[2-[(6S)-2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pyrido[2,3-d]pyrimidin-6-yl]ethyl]-N-[(3S)-2,6-dioxoheptan-3-yl]-4-methylthiophene-2-carboxamide.
| Compound Name | 5-[2-[(6S)-2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pyrido[2,3-d]pyrimidin-6-yl]ethyl]-N-[(3S)-2,6-dioxoheptan-3-yl]-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 135992025 |
| Molecular Formula | C22H29N5O4S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 5-[2-[(6S)-2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pyrido[2,3-d]pyrimidin-6-yl]ethyl]-N-[(3S)-2,6-dioxoheptan-3-yl]-4-methylthiophene-2-carboxamide |
| SMILES | CC(=O)CC[C@H](NC(=O)c1cc(C)c(CC[C@@H]2CNc3nc(N)[nH]c(=O)c3C2)s1)C(C)=O |
| InChI | InChI=1S/C22H29N5O4S/c1-11-8-18(21(31)25-16(13(3)29)6-4-12(2)28)32-17(11)7-5-14-9-15-19(24-10-14)26-22(23)27-20(15)30/h8,14,16H,4-7,9-10H2,1-3H3,(H,25,31)(H4,23,24,26,27,30)/t14-,16-/m0/s1 |
| InChIKey | QJQPIFLUPILROV-HOCLYGCPSA-N |
| XLogP | 2.00 |
| TPSA | 147.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |