C14H16N4O3S2 — CID 135467755
5-[2-[(6R)-2-amino-4-oxo-3,6,7,8-tetrahydropyrimido[5,4-b][1,4]thiazin-6-yl]ethyl]-4-methylthiophene-2-carboxylic acid (PubChem CID 135467755) has the molecular formula C14H16N4O3S2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 5-[2-[(6R)-2-amino-4-oxo-3,6,7,8-tetrahydropyrimido[5,4-b][1,4]thiazin-6-yl]ethyl]-4-methylthiophene-2-carboxylic acid.
| Compound Name | 5-[2-[(6R)-2-amino-4-oxo-3,6,7,8-tetrahydropyrimido[5,4-b][1,4]thiazin-6-yl]ethyl]-4-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 135467755 |
| Molecular Formula | C14H16N4O3S2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 5-[2-[(6R)-2-amino-4-oxo-3,6,7,8-tetrahydropyrimido[5,4-b][1,4]thiazin-6-yl]ethyl]-4-methylthiophene-2-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)sc1CC[C@@H]1CNc2nc(N)[nH]c(=O)c2S1 |
| InChI | InChI=1S/C14H16N4O3S2/c1-6-4-9(13(20)21)23-8(6)3-2-7-5-16-11-10(22-7)12(19)18-14(15)17-11/h4,7H,2-3,5H2,1H3,(H,20,21)(H4,15,16,17,18,19)/t7-/m1/s1 |
| InChIKey | GMAGBHPGOSQIJF-SSDOTTSWSA-N |
| XLogP | 1.94 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |