C24H30N4O7S — CID 136671152
5-[2-[2-(2,2-dimethylpropanoylamino)-8-(2-ethoxy-2-oxoacetyl)-4-oxo-3,5,6,7-tetrahydropyrido[2,3-d]pyrimidin-6-yl]ethyl]-4-methylthiophene-2-carboxylic acid (PubChem CID 136671152) has the molecular formula C24H30N4O7S and a molecular weight of 518.59 g/mol. Its IUPAC name is 5-[2-[2-(2,2-dimethylpropanoylamino)-8-(2-ethoxy-2-oxoacetyl)-4-oxo-3,5,6,7-tetrahydropyrido[2,3-d]pyrimidin-6-yl]ethyl]-4-methylthiophene-2-carboxylic acid.
| Compound Name | 5-[2-[2-(2,2-dimethylpropanoylamino)-8-(2-ethoxy-2-oxoacetyl)-4-oxo-3,5,6,7-tetrahydropyrido[2,3-d]pyrimidin-6-yl]ethyl]-4-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 136671152 |
| Molecular Formula | C24H30N4O7S |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | 5-[2-[2-(2,2-dimethylpropanoylamino)-8-(2-ethoxy-2-oxoacetyl)-4-oxo-3,5,6,7-tetrahydropyrido[2,3-d]pyrimidin-6-yl]ethyl]-4-methylthiophene-2-carboxylic acid |
| SMILES | CCOC(=O)C(=O)N1CC(CCc2sc(C(=O)O)cc2C)Cc2c1nc(NC(=O)C(C)(C)C)[nH]c2=O |
| InChI | InChI=1S/C24H30N4O7S/c1-6-35-21(33)19(30)28-11-13(7-8-15-12(2)9-16(36-15)20(31)32)10-14-17(28)25-23(26-18(14)29)27-22(34)24(3,4)5/h9,13H,6-8,10-11H2,1-5H3,(H,31,32)(H2,25,26,27,29,34) |
| InChIKey | YTWBXEBSNUBRSO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 158.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|