C26H41N5O7 — CID 135979286
dimethyl (2S)-2-[7-[2-(2,2-dimethylpropanoylamino)-4-oxo-5,6,7,8-tetrahydro-3H-pyrido[2,3-d]pyrimidin-6-yl]heptanoylamino]pentanedioate (PubChem CID 135979286) has the molecular formula C26H41N5O7 and a molecular weight of 535.64 g/mol. Its IUPAC name is dimethyl (2S)-2-[7-[2-(2,2-dimethylpropanoylamino)-4-oxo-5,6,7,8-tetrahydro-3H-pyrido[2,3-d]pyrimidin-6-yl]heptanoylamino]pentanedioate.
| Compound Name | dimethyl (2S)-2-[7-[2-(2,2-dimethylpropanoylamino)-4-oxo-5,6,7,8-tetrahydro-3H-pyrido[2,3-d]pyrimidin-6-yl]heptanoylamino]pentanedioate |
|---|---|
| PubChem CID | 135979286 |
| Molecular Formula | C26H41N5O7 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.30 |
| IUPAC Name | dimethyl (2S)-2-[7-[2-(2,2-dimethylpropanoylamino)-4-oxo-5,6,7,8-tetrahydro-3H-pyrido[2,3-d]pyrimidin-6-yl]heptanoylamino]pentanedioate |
| SMILES | COC(=O)CC[C@H](NC(=O)CCCCCCC1CNc2nc(NC(=O)C(C)(C)C)[nH]c(=O)c2C1)C(=O)OC |
| InChI | InChI=1S/C26H41N5O7/c1-26(2,3)24(36)31-25-29-21-17(22(34)30-25)14-16(15-27-21)10-8-6-7-9-11-19(32)28-18(23(35)38-5)12-13-20(33)37-4/h16,18H,6-15H2,1-5H3,(H,28,32)(H3,27,29,30,31,34,36)/t16?,18-/m0/s1 |
| InChIKey | FPXBKICDZFLVDU-DAFXYXGESA-N |
| XLogP | 2.29 |
| TPSA | 168.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|