C26H28N6O7 — CID 136813090
dimethyl (2S)-2-[[4-[2-[2-(2,2-dimethylpropanoylamino)-6-oxo-1,7-dihydropurin-8-yl]ethynyl]benzoyl]amino]pentanedioate (PubChem CID 136813090) has the molecular formula C26H28N6O7 and a molecular weight of 536.55 g/mol. Its IUPAC name is dimethyl (2S)-2-[[4-[2-[2-(2,2-dimethylpropanoylamino)-6-oxo-1,7-dihydropurin-8-yl]ethynyl]benzoyl]amino]pentanedioate.
| Compound Name | dimethyl (2S)-2-[[4-[2-[2-(2,2-dimethylpropanoylamino)-6-oxo-1,7-dihydropurin-8-yl]ethynyl]benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 136813090 |
| Molecular Formula | C26H28N6O7 |
| Molecular Weight | 536.55 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | dimethyl (2S)-2-[[4-[2-[2-(2,2-dimethylpropanoylamino)-6-oxo-1,7-dihydropurin-8-yl]ethynyl]benzoyl]amino]pentanedioate |
| SMILES | COC(=O)CC[C@H](NC(=O)c1ccc(C#Cc2nc3nc(NC(=O)C(C)(C)C)[nH]c(=O)c3[nH]2)cc1)C(=O)OC |
| InChI | InChI=1S/C26H28N6O7/c1-26(2,3)24(37)32-25-30-20-19(22(35)31-25)28-17(29-20)12-8-14-6-9-15(10-7-14)21(34)27-16(23(36)39-5)11-13-18(33)38-4/h6-7,9-10,16H,11,13H2,1-5H3,(H,27,34)(H3,28,29,30,31,32,35,37)/t16-/m0/s1 |
| InChIKey | BCMGVGKOCNHIOJ-INIZCTEOSA-N |
| XLogP | 1.26 |
| TPSA | 185.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.55 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|