C19H20N6O5 — CID 138756578
dimethyl (2S)-2-[[4-(7H-purin-6-ylamino)benzoyl]amino]pentanedioate (PubChem CID 138756578) has the molecular formula C19H20N6O5 and a molecular weight of 412.41 g/mol. Its IUPAC name is dimethyl (2S)-2-[[4-(7H-purin-6-ylamino)benzoyl]amino]pentanedioate.
| Compound Name | dimethyl (2S)-2-[[4-(7H-purin-6-ylamino)benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 138756578 |
| Molecular Formula | C19H20N6O5 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | dimethyl (2S)-2-[[4-(7H-purin-6-ylamino)benzoyl]amino]pentanedioate |
| SMILES | COC(=O)CC[C@H](NC(=O)c1ccc(Nc2ncnc3nc[nH]c23)cc1)C(=O)OC |
| InChI | InChI=1S/C19H20N6O5/c1-29-14(26)8-7-13(19(28)30-2)25-18(27)11-3-5-12(6-4-11)24-17-15-16(21-9-20-15)22-10-23-17/h3-6,9-10,13H,7-8H2,1-2H3,(H,25,27)(H2,20,21,22,23,24)/t13-/m0/s1 |
| InChIKey | VJQIWQBJMHDENC-ZDUSSCGKSA-N |
| XLogP | 1.32 |
| TPSA | 148.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |