C31H42N6O8 — CID 135474508
diethyl (2S)-2-[[4-[2-[2-(2,2-dimethylpropanoylamino)-4-oxo-5,6,7,8-tetrahydro-3H-pyrido[2,3-d]pyrimidin-6-yl]ethyl-formylamino]benzoyl]amino]pentanedioate (PubChem CID 135474508) has the molecular formula C31H42N6O8 and a molecular weight of 626.71 g/mol. Its IUPAC name is diethyl (2S)-2-[[4-[2-[2-(2,2-dimethylpropanoylamino)-4-oxo-5,6,7,8-tetrahydro-3H-pyrido[2,3-d]pyrimidin-6-yl]ethyl-formylamino]benzoyl]amino]pentanedioate.
| Compound Name | diethyl (2S)-2-[[4-[2-[2-(2,2-dimethylpropanoylamino)-4-oxo-5,6,7,8-tetrahydro-3H-pyrido[2,3-d]pyrimidin-6-yl]ethyl-formylamino]benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 135474508 |
| Molecular Formula | C31H42N6O8 |
| Molecular Weight | 626.71 g/mol |
| Exact Mass | 626.31 |
| IUPAC Name | diethyl (2S)-2-[[4-[2-[2-(2,2-dimethylpropanoylamino)-4-oxo-5,6,7,8-tetrahydro-3H-pyrido[2,3-d]pyrimidin-6-yl]ethyl-formylamino]benzoyl]amino]pentanedioate |
| SMILES | CCOC(=O)CC[C@H](NC(=O)c1ccc(N(C=O)CCC2CNc3nc(NC(=O)C(C)(C)C)[nH]c(=O)c3C2)cc1)C(=O)OCC |
| InChI | InChI=1S/C31H42N6O8/c1-6-44-24(39)13-12-23(28(42)45-7-2)33-26(40)20-8-10-21(11-9-20)37(18-38)15-14-19-16-22-25(32-17-19)34-30(35-27(22)41)36-29(43)31(3,4)5/h8-11,18-19,23H,6-7,12-17H2,1-5H3,(H,33,40)(H3,32,34,35,36,41,43)/t19?,23-/m0/s1 |
| InChIKey | GKCWDZKQBXEHIF-BVHINDKJSA-N |
| XLogP | 2.40 |
| TPSA | 188.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.71 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|