C15H15N3O — CID 135993110
1,5-bis(methylamino)acridin-3-ol (PubChem CID 135993110) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is 1,5-bis(methylamino)acridin-3-ol.
| Compound Name | 1,5-bis(methylamino)acridin-3-ol |
|---|---|
| PubChem CID | 135993110 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 1,5-bis(methylamino)acridin-3-ol |
| SMILES | CNc1cc(O)cc2nc3c(NC)cccc3cc12 |
| InChI | InChI=1S/C15H15N3O/c1-16-12-5-3-4-9-6-11-13(17-2)7-10(19)8-14(11)18-15(9)12/h3-8,16-17,19H,1-2H3 |
| InChIKey | CJVVKAFAZSKUPF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|