About N-methylacridin-4-amine;N-phenylbenzamide
N-methylacridin-4-amine;N-phenylbenzamide (PubChem CID 174981104) has the molecular formula C27H23N3O
and a molecular weight of 405.50 g/mol. Its IUPAC name is N-methylacridin-4-amine;N-phenylbenzamide.
Molecular Properties
| Compound Name | N-methylacridin-4-amine;N-phenylbenzamide |
| PubChem CID | 174981104 |
| Molecular Formula | C27H23N3O |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | N-methylacridin-4-amine;N-phenylbenzamide |
| SMILES | CNc1cccc2cc3ccccc3nc12.O=C(Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12N2.C13H11NO/c1-15-13-8-4-6-11-9-10-5-2-3-7-12(10)16-14(11)13;15-13(11-7-3-1-4-8-11)14-12-9-5-2-6-10-12/h2-9,15H,1H3;1-10H,(H,14,15) |
| InChIKey | JHVURZXBKZYGSK-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze N-methylacridin-4-amine;N-phenylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylacridin-4-amine;N-phenylbenzamide?
The IUPAC name of N-methylacridin-4-amine;N-phenylbenzamide (CID 174981104) is N-methylacridin-4-amine;N-phenylbenzamide.
What is the SMILES notation for N-methylacridin-4-amine;N-phenylbenzamide?
The canonical SMILES for N-methylacridin-4-amine;N-phenylbenzamide is CNc1cccc2cc3ccccc3nc12.O=C(Nc1ccccc1)c1ccccc1.
What is the InChIKey of N-methylacridin-4-amine;N-phenylbenzamide?
The InChIKey is JHVURZXBKZYGSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2.C13H11NO/c1-15-13-8-4-6-11-9-10-5-2-3-7-12(10)16-14(11)13;15-13(11-7-3-1-4-8-11)14-12-9-5-2-6-10-12/h2-9,15H,1H3;1-10H,(H,14,15).
What are the key properties of N-methylacridin-4-amine;N-phenylbenzamide?
N-methylacridin-4-amine;N-phenylbenzamide has a molecular weight of 405.50 g/mol, XLogP of 6.37, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylacridin-4-amine;N-phenylbenzamide is sourced from PubChem (CID 174981104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).