C22H15N5O2 — CID 135995903
1-(4-cyanophenyl)-3-[4-[(2-oxo-1H-indol-3-ylidene)amino]phenyl]urea (PubChem CID 135995903) has the molecular formula C22H15N5O2 and a molecular weight of 381.40 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-[4-[(2-oxo-1H-indol-3-ylidene)amino]phenyl]urea.
| Compound Name | 1-(4-cyanophenyl)-3-[4-[(2-oxo-1H-indol-3-ylidene)amino]phenyl]urea |
|---|---|
| PubChem CID | 135995903 |
| Molecular Formula | C22H15N5O2 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 1-(4-cyanophenyl)-3-[4-[(2-oxo-1H-indol-3-ylidene)amino]phenyl]urea |
| SMILES | N#Cc1ccc(NC(=O)Nc2ccc(/N=C3\C(=O)Nc4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C22H15N5O2/c23-13-14-5-7-16(8-6-14)25-22(29)26-17-11-9-15(10-12-17)24-20-18-3-1-2-4-19(18)27-21(20)28/h1-12H,(H,24,27,28)(H2,25,26,29) |
| InChIKey | WVTGOMUADLQPLS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|