C16H10N2O3 — CID 135995954
7-hydroxy-3-pyrazolo[1,5-a]pyridin-2-ylchromen-2-one (PubChem CID 135995954) has the molecular formula C16H10N2O3 and a molecular weight of 278.27 g/mol. Its IUPAC name is 7-hydroxy-3-pyrazolo[1,5-a]pyridin-2-ylchromen-2-one.
| Compound Name | 7-hydroxy-3-pyrazolo[1,5-a]pyridin-2-ylchromen-2-one |
|---|---|
| PubChem CID | 135995954 |
| Molecular Formula | C16H10N2O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 7-hydroxy-3-pyrazolo[1,5-a]pyridin-2-ylchromen-2-one |
| SMILES | O=c1oc2cc(O)ccc2cc1-c1cc2ccccn2n1 |
| InChI | InChI=1S/C16H10N2O3/c19-12-5-4-10-7-13(16(20)21-15(10)9-12)14-8-11-3-1-2-6-18(11)17-14/h1-9,19H |
| InChIKey | SMIXUQPTRQSJSE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 67.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|