C23H18BrN7O — CID 135995982
3-benzyl-2-[3-bromo-2-hydroxy-5-(2H-tetrazol-5-yl)phenyl]-1H-indole-5-carboximidamide (PubChem CID 135995982) has the molecular formula C23H18BrN7O and a molecular weight of 488.35 g/mol. Its IUPAC name is 3-benzyl-2-[3-bromo-2-hydroxy-5-(2H-tetrazol-5-yl)phenyl]-1H-indole-5-carboximidamide.
| Compound Name | 3-benzyl-2-[3-bromo-2-hydroxy-5-(2H-tetrazol-5-yl)phenyl]-1H-indole-5-carboximidamide |
|---|---|
| PubChem CID | 135995982 |
| Molecular Formula | C23H18BrN7O |
| Molecular Weight | 488.35 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | 3-benzyl-2-[3-bromo-2-hydroxy-5-(2H-tetrazol-5-yl)phenyl]-1H-indole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2[nH]c(-c3cc(-c4nn[nH]n4)cc(Br)c3O)c(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C23H18BrN7O/c24-18-11-14(23-28-30-31-29-23)10-17(21(18)32)20-16(8-12-4-2-1-3-5-12)15-9-13(22(25)26)6-7-19(15)27-20/h1-7,9-11,27,32H,8H2,(H3,25,26)(H,28,29,30,31) |
| InChIKey | CHAKXPPMMOYNDT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 140.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.35 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|