C19H17N9 — CID 135998096
N-methyl-N-(2-pyridin-2-ylethyl)-2,3,4,5,9,11,13-heptazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,5,7,9,11,14,16-octaen-10-amine (PubChem CID 135998096) has the molecular formula C19H17N9 and a molecular weight of 371.41 g/mol. Its IUPAC name is N-methyl-N-(2-pyridin-2-ylethyl)-2,3,4,5,9,11,13-heptazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,5,7,9,11,14,16-octaen-10-amine.
| Compound Name | N-methyl-N-(2-pyridin-2-ylethyl)-2,3,4,5,9,11,13-heptazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,5,7,9,11,14,16-octaen-10-amine |
|---|---|
| PubChem CID | 135998096 |
| Molecular Formula | C19H17N9 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | N-methyl-N-(2-pyridin-2-ylethyl)-2,3,4,5,9,11,13-heptazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,5,7,9,11,14,16-octaen-10-amine |
| SMILES | CN(CCc1ccccn1)c1ncc2c(n1)Nc1ccccc1-n1nnnc1-2 |
| InChI | InChI=1S/C19H17N9/c1-27(11-9-13-6-4-5-10-20-13)19-21-12-14-17(23-19)22-15-7-2-3-8-16(15)28-18(14)24-25-26-28/h2-8,10,12H,9,11H2,1H3,(H,21,22,23) |
| InChIKey | XEGQPQMFELFLQP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |