C24H22N6O2S — CID 135998718
4-[5-methyl-10-(6-phenyl-3-pyridinyl)-1,3,4,8,12-pentazatricyclo[7.3.0.02,6]dodeca-2,5,7,9,11-pentaen-7-yl]thiane 1,1-dioxide (PubChem CID 135998718) has the molecular formula C24H22N6O2S and a molecular weight of 458.55 g/mol. Its IUPAC name is 4-[5-methyl-10-(6-phenyl-3-pyridinyl)-1,3,4,8,12-pentazatricyclo[7.3.0.02,6]dodeca-2,5,7,9,11-pentaen-7-yl]thiane 1,1-dioxide.
| Compound Name | 4-[5-methyl-10-(6-phenyl-3-pyridinyl)-1,3,4,8,12-pentazatricyclo[7.3.0.02,6]dodeca-2,5,7,9,11-pentaen-7-yl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 135998718 |
| Molecular Formula | C24H22N6O2S |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 4-[5-methyl-10-(6-phenyl-3-pyridinyl)-1,3,4,8,12-pentazatricyclo[7.3.0.02,6]dodeca-2,5,7,9,11-pentaen-7-yl]thiane 1,1-dioxide |
| SMILES | Cc1[nH]nc2c1c(C1CCS(=O)(=O)CC1)nc1c(-c3ccc(-c4ccccc4)nc3)cnn12 |
| InChI | InChI=1S/C24H22N6O2S/c1-15-21-22(17-9-11-33(31,32)12-10-17)27-23-19(14-26-30(23)24(21)29-28-15)18-7-8-20(25-13-18)16-5-3-2-4-6-16/h2-8,13-14,17H,9-12H2,1H3,(H,28,29) |
| InChIKey | HNXDCKVZVMADCY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |