C30H37N11O2 — CID 137161309
tert-butyl 4-[5-methyl-10-[6-(2,3,4,5,6-pentaaminophenyl)-3-pyridinyl]-1,3,4,8,12-pentazatricyclo[7.3.0.02,6]dodeca-2,5,7,9,11-pentaen-7-yl]cyclohexane-1-carboxylate (PubChem CID 137161309) has the molecular formula C30H37N11O2 and a molecular weight of 583.70 g/mol. Its IUPAC name is tert-butyl 4-[5-methyl-10-[6-(2,3,4,5,6-pentaaminophenyl)-3-pyridinyl]-1,3,4,8,12-pentazatricyclo[7.3.0.02,6]dodeca-2,5,7,9,11-pentaen-7-yl]cyclohexane-1-carboxylate.
| Compound Name | tert-butyl 4-[5-methyl-10-[6-(2,3,4,5,6-pentaaminophenyl)-3-pyridinyl]-1,3,4,8,12-pentazatricyclo[7.3.0.02,6]dodeca-2,5,7,9,11-pentaen-7-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 137161309 |
| Molecular Formula | C30H37N11O2 |
| Molecular Weight | 583.70 g/mol |
| Exact Mass | 583.31 |
| IUPAC Name | tert-butyl 4-[5-methyl-10-[6-(2,3,4,5,6-pentaaminophenyl)-3-pyridinyl]-1,3,4,8,12-pentazatricyclo[7.3.0.02,6]dodeca-2,5,7,9,11-pentaen-7-yl]cyclohexane-1-carboxylate |
| SMILES | Cc1[nH]nc2c1c(C1CCC(C(=O)OC(C)(C)C)CC1)nc1c(-c3ccc(-c4c(N)c(N)c(N)c(N)c4N)nc3)cnn12 |
| InChI | InChI=1S/C30H37N11O2/c1-13-19-26(14-5-7-15(8-6-14)29(42)43-30(2,3)4)38-27-17(12-37-41(27)28(19)40-39-13)16-9-10-18(36-11-16)20-21(31)23(33)25(35)24(34)22(20)32/h9-12,14-15H,5-8,31-35H2,1-4H3,(H,39,40) |
| InChIKey | QDAXLINKQQMTSP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 228.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.70 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|