C12H10N4O — CID 135999292
4-(1H-pyrazolo[4,3-b]pyridin-7-ylamino)phenol (PubChem CID 135999292) has the molecular formula C12H10N4O and a molecular weight of 226.24 g/mol. Its IUPAC name is 4-(1H-pyrazolo[4,3-b]pyridin-7-ylamino)phenol.
| Compound Name | 4-(1H-pyrazolo[4,3-b]pyridin-7-ylamino)phenol |
|---|---|
| PubChem CID | 135999292 |
| Molecular Formula | C12H10N4O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 4-(1H-pyrazolo[4,3-b]pyridin-7-ylamino)phenol |
| SMILES | Oc1ccc(Nc2ccnc3cn[nH]c23)cc1 |
| InChI | InChI=1S/C12H10N4O/c17-9-3-1-8(2-4-9)15-10-5-6-13-11-7-14-16-12(10)11/h1-7,17H,(H,13,15)(H,14,16) |
| InChIKey | XMHWUAMYKWSYCH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|