C13H11N3O2S — CID 1360976
3-(2-amino-4-hydroxy-1,3-thiazol-5-yl)-5,7-dimethylindol-2-one (PubChem CID 1360976) has the molecular formula C13H11N3O2S and a molecular weight of 273.32 g/mol. Its IUPAC name is 3-(2-amino-4-hydroxy-1,3-thiazol-5-yl)-5,7-dimethylindol-2-one.
| Compound Name | 3-(2-amino-4-hydroxy-1,3-thiazol-5-yl)-5,7-dimethylindol-2-one |
|---|---|
| PubChem CID | 1360976 |
| Molecular Formula | C13H11N3O2S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 3-(2-amino-4-hydroxy-1,3-thiazol-5-yl)-5,7-dimethylindol-2-one |
| SMILES | Cc1cc(C)c2c(c1)=C(c1sc(N)nc1O)C(=O)N=2 |
| InChI | InChI=1S/C13H11N3O2S/c1-5-3-6(2)9-7(4-5)8(11(17)15-9)10-12(18)16-13(14)19-10/h3-4,18H,1-2H3,(H2,14,16) |
| InChIKey | YBKPWWWWNUUBEY-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |