C11H6FN3O2S — CID 3581259
3-(2-amino-4-hydroxy-1,3-thiazol-5-yl)-5-fluoroindol-2-one (PubChem CID 3581259) has the molecular formula C11H6FN3O2S and a molecular weight of 263.25 g/mol. Its IUPAC name is 3-(2-amino-4-hydroxy-1,3-thiazol-5-yl)-5-fluoroindol-2-one.
| Compound Name | 3-(2-amino-4-hydroxy-1,3-thiazol-5-yl)-5-fluoroindol-2-one |
|---|---|
| PubChem CID | 3581259 |
| Molecular Formula | C11H6FN3O2S |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 3-(2-amino-4-hydroxy-1,3-thiazol-5-yl)-5-fluoroindol-2-one |
| SMILES | Nc1nc(O)c(C2=c3cc(F)ccc3=NC2=O)s1 |
| InChI | InChI=1S/C11H6FN3O2S/c12-4-1-2-6-5(3-4)7(9(16)14-6)8-10(17)15-11(13)18-8/h1-3,17H,(H2,13,15) |
| InChIKey | KPFXKZFJLBYXRM-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |