C12H9N3O2S — CID 1396206
3-(2-amino-4-hydroxy-1,3-thiazol-5-yl)-5-methylindol-2-one (PubChem CID 1396206) has the molecular formula C12H9N3O2S and a molecular weight of 259.29 g/mol. Its IUPAC name is 3-(2-amino-4-hydroxy-1,3-thiazol-5-yl)-5-methylindol-2-one.
| Compound Name | 3-(2-amino-4-hydroxy-1,3-thiazol-5-yl)-5-methylindol-2-one |
|---|---|
| PubChem CID | 1396206 |
| Molecular Formula | C12H9N3O2S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 3-(2-amino-4-hydroxy-1,3-thiazol-5-yl)-5-methylindol-2-one |
| SMILES | Cc1ccc2c(c1)=C(c1sc(N)nc1O)C(=O)N=2 |
| InChI | InChI=1S/C12H9N3O2S/c1-5-2-3-7-6(4-5)8(10(16)14-7)9-11(17)15-12(13)18-9/h2-4,17H,1H3,(H2,13,15) |
| InChIKey | MJFAFVAQEWOGIG-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |