About (3S,4R)-4-aminothiolan-3-ol
(3S,4R)-4-aminothiolan-3-ol (PubChem CID 1361798) has the molecular formula C4H9NOS
and a molecular weight of 119.19 g/mol. Its IUPAC name is (3S,4R)-4-aminothiolan-3-ol.
Molecular Properties
| Compound Name | (3S,4R)-4-aminothiolan-3-ol |
| PubChem CID | 1361798 |
| Molecular Formula | C4H9NOS |
| Molecular Weight | 119.19 g/mol |
| Exact Mass | 119.04 |
| IUPAC Name | (3S,4R)-4-aminothiolan-3-ol |
| SMILES | N[C@H]1CSC[C@H]1O |
| InChI | InChI=1S/C4H9NOS/c5-3-1-7-2-4(3)6/h3-4,6H,1-2,5H2/t3-,4+/m0/s1 |
| InChIKey | LNYNSKJTNYTLNL-IUYQGCFVSA-N |
| XLogP | -0.58 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.19 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S,4R)-4-aminothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-4-aminothiolan-3-ol?
The IUPAC name of (3S,4R)-4-aminothiolan-3-ol (CID 1361798) is (3S,4R)-4-aminothiolan-3-ol.
What is the SMILES notation for (3S,4R)-4-aminothiolan-3-ol?
The canonical SMILES for (3S,4R)-4-aminothiolan-3-ol is N[C@H]1CSC[C@H]1O.
What is the InChIKey of (3S,4R)-4-aminothiolan-3-ol?
The InChIKey is LNYNSKJTNYTLNL-IUYQGCFVSA-N. The full InChI is InChI=1S/C4H9NOS/c5-3-1-7-2-4(3)6/h3-4,6H,1-2,5H2/t3-,4+/m0/s1.
What are the key properties of (3S,4R)-4-aminothiolan-3-ol?
(3S,4R)-4-aminothiolan-3-ol has a molecular weight of 119.19 g/mol, XLogP of -0.58, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-4-aminothiolan-3-ol is sourced from PubChem (CID 1361798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).