C21H15N3O5S — CID 1363698
N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-2-(2-nitrophenoxy)acetamide (PubChem CID 1363698) has the molecular formula C21H15N3O5S and a molecular weight of 421.43 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-2-(2-nitrophenoxy)acetamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-2-(2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 1363698 |
| Molecular Formula | C21H15N3O5S |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-2-(2-nitrophenoxy)acetamide |
| SMILES | O=C(COc1ccccc1[N+](=O)[O-])Nc1ccc(O)c(-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C21H15N3O5S/c25-17-10-9-13(11-14(17)21-23-15-5-1-4-8-19(15)30-21)22-20(26)12-29-18-7-3-2-6-16(18)24(27)28/h1-11,25H,12H2,(H,22,26) |
| InChIKey | HCOCVZUZJKUXLE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|