C25H19N7OS — CID 1364154
2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(quinolin-8-ylmethylideneamino)acetamide (PubChem CID 1364154) has the molecular formula C25H19N7OS and a molecular weight of 465.54 g/mol. Its IUPAC name is 2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(quinolin-8-ylmethylideneamino)acetamide.
| Compound Name | 2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(quinolin-8-ylmethylideneamino)acetamide |
|---|---|
| PubChem CID | 1364154 |
| Molecular Formula | C25H19N7OS |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(quinolin-8-ylmethylideneamino)acetamide |
| SMILES | O=C(CSc1nnc(-c2ccncc2)n1-c1ccccc1)NN=Cc1cccc2cccnc12 |
| InChI | InChI=1S/C25H19N7OS/c33-22(29-28-16-20-7-4-6-18-8-5-13-27-23(18)20)17-34-25-31-30-24(19-11-14-26-15-12-19)32(25)21-9-2-1-3-10-21/h1-16H,17H2,(H,29,33) |
| InChIKey | DSPXQWDHWVOVNT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|