C21H21NO5 — CID 136502284
2-methoxy-6-[6-(3,4,5-trimethoxyphenyl)-2-pyridinyl]phenol (PubChem CID 136502284) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is 2-methoxy-6-[6-(3,4,5-trimethoxyphenyl)-2-pyridinyl]phenol.
| Compound Name | 2-methoxy-6-[6-(3,4,5-trimethoxyphenyl)-2-pyridinyl]phenol |
|---|---|
| PubChem CID | 136502284 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 2-methoxy-6-[6-(3,4,5-trimethoxyphenyl)-2-pyridinyl]phenol |
| SMILES | COc1cccc(-c2cccc(-c3cc(OC)c(OC)c(OC)c3)n2)c1O |
| InChI | InChI=1S/C21H21NO5/c1-24-17-10-5-7-14(20(17)23)16-9-6-8-15(22-16)13-11-18(25-2)21(27-4)19(12-13)26-3/h5-12,23H,1-4H3 |
| InChIKey | KQBMYUNYMDGESD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |