C17H25N3O2 — CID 136504195
1-(tert-butylamino)-3-[(E)-1-(1H-indol-3-yl)ethylideneamino]oxypropan-2-ol (PubChem CID 136504195) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-(tert-butylamino)-3-[(E)-1-(1H-indol-3-yl)ethylideneamino]oxypropan-2-ol.
| Compound Name | 1-(tert-butylamino)-3-[(E)-1-(1H-indol-3-yl)ethylideneamino]oxypropan-2-ol |
|---|---|
| PubChem CID | 136504195 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 1-(tert-butylamino)-3-[(E)-1-(1H-indol-3-yl)ethylideneamino]oxypropan-2-ol |
| SMILES | C/C(=N\OCC(O)CNC(C)(C)C)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H25N3O2/c1-12(15-10-18-16-8-6-5-7-14(15)16)20-22-11-13(21)9-19-17(2,3)4/h5-8,10,13,18-19,21H,9,11H2,1-4H3/b20-12+ |
| InChIKey | RYEZHYDUXMCULU-UDWIEESQSA-N |
| XLogP | 2.66 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|