C15H25N5O — CID 136504209
2-amino-6-nonyl-7,8-dihydro-3H-pteridin-4-one (PubChem CID 136504209) has the molecular formula C15H25N5O and a molecular weight of 291.40 g/mol. Its IUPAC name is 2-amino-6-nonyl-7,8-dihydro-3H-pteridin-4-one.
| Compound Name | 2-amino-6-nonyl-7,8-dihydro-3H-pteridin-4-one |
|---|---|
| PubChem CID | 136504209 |
| Molecular Formula | C15H25N5O |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | 2-amino-6-nonyl-7,8-dihydro-3H-pteridin-4-one |
| SMILES | CCCCCCCCCC1=Nc2c(nc(N)[nH]c2=O)NC1 |
| InChI | InChI=1S/C15H25N5O/c1-2-3-4-5-6-7-8-9-11-10-17-13-12(18-11)14(21)20-15(16)19-13/h2-10H2,1H3,(H4,16,17,19,20,21) |
| InChIKey | SYTKJEJNEVPNBI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|