C9H18N6O — CID 135584213
2,5-diamino-4-(1-aminopentylamino)-1H-pyrimidin-6-one (PubChem CID 135584213) has the molecular formula C9H18N6O and a molecular weight of 226.28 g/mol. Its IUPAC name is 2,5-diamino-4-(1-aminopentylamino)-1H-pyrimidin-6-one.
| Compound Name | 2,5-diamino-4-(1-aminopentylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135584213 |
| Molecular Formula | C9H18N6O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 2,5-diamino-4-(1-aminopentylamino)-1H-pyrimidin-6-one |
| SMILES | CCCCC(N)Nc1nc(N)[nH]c(=O)c1N |
| InChI | InChI=1S/C9H18N6O/c1-2-3-4-5(10)13-7-6(11)8(16)15-9(12)14-7/h5H,2-4,10-11H2,1H3,(H4,12,13,14,15,16) |
| InChIKey | BEQNLRKLTJEINX-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 135.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|