C9H13F3N4O — CID 137016592
5-amino-4-(5,5,5-trifluoropentylamino)-1H-pyrimidin-6-one (PubChem CID 137016592) has the molecular formula C9H13F3N4O and a molecular weight of 250.22 g/mol. Its IUPAC name is 5-amino-4-(5,5,5-trifluoropentylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-(5,5,5-trifluoropentylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137016592 |
| Molecular Formula | C9H13F3N4O |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 5-amino-4-(5,5,5-trifluoropentylamino)-1H-pyrimidin-6-one |
| SMILES | Nc1c(NCCCCC(F)(F)F)nc[nH]c1=O |
| InChI | InChI=1S/C9H13F3N4O/c10-9(11,12)3-1-2-4-14-7-6(13)8(17)16-5-15-7/h5H,1-4,13H2,(H2,14,15,16,17) |
| InChIKey | WNHBKPKRTUZPPJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|